C20H30N3O2+ — CID 7417542
butyl-[2-[2-(2-ethylphenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-2-oxoethyl]azanium (PubChem CID 7417542) has the molecular formula C20H30N3O2+ and a molecular weight of 344.48 g/mol. Its IUPAC name is butyl-[2-[2-(2-ethylphenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-2-oxoethyl]azanium.
| Compound Name | butyl-[2-[2-(2-ethylphenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7417542 |
| Molecular Formula | C20H30N3O2+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | butyl-[2-[2-(2-ethylphenyl)-3-oxo-5-propyl-1H-pyrazol-4-yl]-2-oxoethyl]azanium |
| SMILES | CCCC[NH2+]CC(=O)c1c(CCC)[nH]n(-c2ccccc2CC)c1=O |
| InChI | InChI=1S/C20H29N3O2/c1-4-7-13-21-14-18(24)19-16(10-5-2)22-23(20(19)25)17-12-9-8-11-15(17)6-3/h8-9,11-12,21-22H,4-7,10,13-14H2,1-3H3/p+1 |
| InChIKey | RLYCVBOFFWIDEE-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|