C14H15N3O2 — CID 7420924
(5R)-7-(4-ethylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione (PubChem CID 7420924) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is (5R)-7-(4-ethylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione.
| Compound Name | (5R)-7-(4-ethylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
|---|---|
| PubChem CID | 7420924 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (5R)-7-(4-ethylphenyl)-1,2,7-triazaspiro[4.4]non-1-ene-6,8-dione |
| SMILES | CCc1ccc(N2C(=O)C[C@]3(CCN=N3)C2=O)cc1 |
| InChI | InChI=1S/C14H15N3O2/c1-2-10-3-5-11(6-4-10)17-12(18)9-14(13(17)19)7-8-15-16-14/h3-6H,2,7-9H2,1H3/t14-/m1/s1 |
| InChIKey | FEYCXAJJQWAEKF-CQSZACIVSA-N |
| XLogP | 2.11 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|