C28H20Cl3N3O — CID 74223021
(3-chlorophenyl)-[2,4-dichloro-3-(N-methylanilino)quinolin-6-yl]-pyridin-3-ylmethanol (PubChem CID 74223021) has the molecular formula C28H20Cl3N3O and a molecular weight of 520.85 g/mol. Its IUPAC name is (3-chlorophenyl)-[2,4-dichloro-3-(N-methylanilino)quinolin-6-yl]-pyridin-3-ylmethanol.
| Compound Name | (3-chlorophenyl)-[2,4-dichloro-3-(N-methylanilino)quinolin-6-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 74223021 |
| Molecular Formula | C28H20Cl3N3O |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | (3-chlorophenyl)-[2,4-dichloro-3-(N-methylanilino)quinolin-6-yl]-pyridin-3-ylmethanol |
| SMILES | CN(c1ccccc1)c1c(Cl)nc2ccc(C(O)(c3cccnc3)c3cccc(Cl)c3)cc2c1Cl |
| InChI | InChI=1S/C28H20Cl3N3O/c1-34(22-10-3-2-4-11-22)26-25(30)23-16-19(12-13-24(23)33-27(26)31)28(35,20-8-6-14-32-17-20)18-7-5-9-21(29)15-18/h2-17,35H,1H3 |
| InChIKey | CXISRSBZHJUAJP-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|