C13H20BrClN2O5S — CID 74223296
[(2-bromophenyl)sulfonylamino] 3-(propan-2-ylamino)propyl carbonate;hydrochloride (PubChem CID 74223296) has the molecular formula C13H20BrClN2O5S and a molecular weight of 431.74 g/mol. Its IUPAC name is [(2-bromophenyl)sulfonylamino] 3-(propan-2-ylamino)propyl carbonate;hydrochloride.
| Compound Name | [(2-bromophenyl)sulfonylamino] 3-(propan-2-ylamino)propyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 74223296 |
| Molecular Formula | C13H20BrClN2O5S |
| Molecular Weight | 431.74 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | [(2-bromophenyl)sulfonylamino] 3-(propan-2-ylamino)propyl carbonate;hydrochloride |
| SMILES | CC(C)NCCCOC(=O)ONS(=O)(=O)c1ccccc1Br.Cl |
| InChI | InChI=1S/C13H19BrN2O5S.ClH/c1-10(2)15-8-5-9-20-13(17)21-16-22(18,19)12-7-4-3-6-11(12)14;/h3-4,6-7,10,15-16H,5,8-9H2,1-2H3;1H |
| InChIKey | PGZJHMDKPPNYGL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|