C29H26N6O13S2 — CID 74223392
N-benzyl-N-[3-(N-(2,4-dinitrophenyl)sulfonyl-4-methoxyanilino)propyl]-2,4-dinitrobenzenesulfonamide (PubChem CID 74223392) has the molecular formula C29H26N6O13S2 and a molecular weight of 730.69 g/mol. Its IUPAC name is N-benzyl-N-[3-(N-(2,4-dinitrophenyl)sulfonyl-4-methoxyanilino)propyl]-2,4-dinitrobenzenesulfonamide.
| Compound Name | N-benzyl-N-[3-(N-(2,4-dinitrophenyl)sulfonyl-4-methoxyanilino)propyl]-2,4-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 74223392 |
| Molecular Formula | C29H26N6O13S2 |
| Molecular Weight | 730.69 g/mol |
| Exact Mass | 730.10 |
| IUPAC Name | N-benzyl-N-[3-(N-(2,4-dinitrophenyl)sulfonyl-4-methoxyanilino)propyl]-2,4-dinitrobenzenesulfonamide |
| SMILES | COc1ccc(N(CCCN(Cc2ccccc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])S(=O)(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H26N6O13S2/c1-48-25-12-8-22(9-13-25)31(50(46,47)29-15-11-24(33(38)39)19-27(29)35(42)43)17-5-16-30(20-21-6-3-2-4-7-21)49(44,45)28-14-10-23(32(36)37)18-26(28)34(40)41/h2-4,6-15,18-19H,5,16-17,20H2,1H3 |
| InChIKey | HOPNGVGHNGHNDN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 256.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.69 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|