About 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide
4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide (PubChem CID 74225965) has the molecular formula C10H15Br2NO2S2
and a molecular weight of 405.18 g/mol. Its IUPAC name is 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide |
| PubChem CID | 74225965 |
| Molecular Formula | C10H15Br2NO2S2 |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide |
| SMILES | CC(C)(C)CCNS(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H15Br2NO2S2/c1-10(2,3)4-5-13-17(14,15)8-6-7(11)9(12)16-8/h6,13H,4-5H2,1-3H3 |
| InChIKey | DJTYDKJRIDUYNV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide?
The IUPAC name of 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide (CID 74225965) is 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide.
What is the SMILES notation for 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide?
The canonical SMILES for 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide is CC(C)(C)CCNS(=O)(=O)c1cc(Br)c(Br)s1.
What is the InChIKey of 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide?
The InChIKey is DJTYDKJRIDUYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Br2NO2S2/c1-10(2,3)4-5-13-17(14,15)8-6-7(11)9(12)16-8/h6,13H,4-5H2,1-3H3.
What are the key properties of 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide?
4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide has a molecular weight of 405.18 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide is sourced from PubChem (CID 74225965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).