C10H15Br2NO2S2 — CID 74225965
4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide (PubChem CID 74225965) has the molecular formula C10H15Br2NO2S2 and a molecular weight of 405.18 g/mol. Its IUPAC name is 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide.
| Compound Name | 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 74225965 |
| Molecular Formula | C10H15Br2NO2S2 |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 4,5-dibromo-N-(3,3-dimethylbutyl)thiophene-2-sulfonamide |
| SMILES | CC(C)(C)CCNS(=O)(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H15Br2NO2S2/c1-10(2,3)4-5-13-17(14,15)8-6-7(11)9(12)16-8/h6,13H,4-5H2,1-3H3 |
| InChIKey | DJTYDKJRIDUYNV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |