C17H20BrFN4S2 — CID 74227356
N-(2-bromo-4-fluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbothioamide (PubChem CID 74227356) has the molecular formula C17H20BrFN4S2 and a molecular weight of 443.41 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 74227356 |
| Molecular Formula | C17H20BrFN4S2 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4-diazepane-1-carbothioamide |
| SMILES | Cc1nc(CN2CCCN(C(=S)Nc3ccc(F)cc3Br)CC2)cs1 |
| InChI | InChI=1S/C17H20BrFN4S2/c1-12-20-14(11-25-12)10-22-5-2-6-23(8-7-22)17(24)21-16-4-3-13(19)9-15(16)18/h3-4,9,11H,2,5-8,10H2,1H3,(H,21,24) |
| InChIKey | KEFMNOJJFOIJMY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|