C23H23NO3 — CID 74227620
[2-[(3-ethynylphenoxy)methyl]morpholin-4-yl]-[(1R,2R)-2-phenylcyclopropyl]methanone (PubChem CID 74227620) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-[(3-ethynylphenoxy)methyl]morpholin-4-yl]-[(1R,2R)-2-phenylcyclopropyl]methanone.
| Compound Name | [2-[(3-ethynylphenoxy)methyl]morpholin-4-yl]-[(1R,2R)-2-phenylcyclopropyl]methanone |
|---|---|
| PubChem CID | 74227620 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [2-[(3-ethynylphenoxy)methyl]morpholin-4-yl]-[(1R,2R)-2-phenylcyclopropyl]methanone |
| SMILES | C#Cc1cccc(OCC2CN(C(=O)[C@@H]3C[C@H]3c3ccccc3)CCO2)c1 |
| InChI | InChI=1S/C23H23NO3/c1-2-17-7-6-10-19(13-17)27-16-20-15-24(11-12-26-20)23(25)22-14-21(22)18-8-4-3-5-9-18/h1,3-10,13,20-22H,11-12,14-16H2/t20?,21-,22+/m0/s1 |
| InChIKey | ODOINOXJJIDOPD-JTGIGXABSA-N |
| XLogP | 3.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|