C27H28FNO4 — CID 4679304
[2-[2-[(3-ethynylphenoxy)methyl]morpholine-4-carbonyl]cyclohexyl]-(4-fluorophenyl)methanone (PubChem CID 4679304) has the molecular formula C27H28FNO4 and a molecular weight of 449.52 g/mol. Its IUPAC name is [2-[2-[(3-ethynylphenoxy)methyl]morpholine-4-carbonyl]cyclohexyl]-(4-fluorophenyl)methanone.
| Compound Name | [2-[2-[(3-ethynylphenoxy)methyl]morpholine-4-carbonyl]cyclohexyl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 4679304 |
| Molecular Formula | C27H28FNO4 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [2-[2-[(3-ethynylphenoxy)methyl]morpholine-4-carbonyl]cyclohexyl]-(4-fluorophenyl)methanone |
| SMILES | C#Cc1cccc(OCC2CN(C(=O)C3CCCCC3C(=O)c3ccc(F)cc3)CCO2)c1 |
| InChI | InChI=1S/C27H28FNO4/c1-2-19-6-5-7-22(16-19)33-18-23-17-29(14-15-32-23)27(31)25-9-4-3-8-24(25)26(30)20-10-12-21(28)13-11-20/h1,5-7,10-13,16,23-25H,3-4,8-9,14-15,17-18H2 |
| InChIKey | HCTKFSXXCOWBCR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|