C20H32N2O7 — CID 74227633
[5-[[4-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]-1,4-diazepan-1-yl]methyl]furan-2-yl]methyl acetate (PubChem CID 74227633) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is [5-[[4-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]-1,4-diazepan-1-yl]methyl]furan-2-yl]methyl acetate.
| Compound Name | [5-[[4-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]-1,4-diazepan-1-yl]methyl]furan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 74227633 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [5-[[4-[2-[2-(2-methoxyethoxy)ethoxy]acetyl]-1,4-diazepan-1-yl]methyl]furan-2-yl]methyl acetate |
| SMILES | COCCOCCOCC(=O)N1CCCN(Cc2ccc(COC(C)=O)o2)CC1 |
| InChI | InChI=1S/C20H32N2O7/c1-17(23)28-15-19-5-4-18(29-19)14-21-6-3-7-22(9-8-21)20(24)16-27-13-12-26-11-10-25-2/h4-5H,3,6-16H2,1-2H3 |
| InChIKey | LNJNVLHGDPRSMD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 90.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|