C20H29N3O6S2 — CID 74227744
dimethyl 2-[[4-[(4-methylsulfonylphenyl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate (PubChem CID 74227744) has the molecular formula C20H29N3O6S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is dimethyl 2-[[4-[(4-methylsulfonylphenyl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate.
| Compound Name | dimethyl 2-[[4-[(4-methylsulfonylphenyl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate |
|---|---|
| PubChem CID | 74227744 |
| Molecular Formula | C20H29N3O6S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | dimethyl 2-[[4-[(4-methylsulfonylphenyl)methyl]-1,4-diazepane-1-carbothioyl]amino]butanedioate |
| SMILES | COC(=O)CC(NC(=S)N1CCCN(Cc2ccc(S(C)(=O)=O)cc2)CC1)C(=O)OC |
| InChI | InChI=1S/C20H29N3O6S2/c1-28-18(24)13-17(19(25)29-2)21-20(30)23-10-4-9-22(11-12-23)14-15-5-7-16(8-6-15)31(3,26)27/h5-8,17H,4,9-14H2,1-3H3,(H,21,30) |
| InChIKey | OLSLYSFOEGNICN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|