C22H33N5O5S — CID 74228365
ethyl 4-[[4-[[2-[(Z)-1-thiophen-2-ylethylideneamino]oxyacetyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 74228365) has the molecular formula C22H33N5O5S and a molecular weight of 479.60 g/mol. Its IUPAC name is ethyl 4-[[4-[[2-[(Z)-1-thiophen-2-ylethylideneamino]oxyacetyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[[2-[(Z)-1-thiophen-2-ylethylideneamino]oxyacetyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 74228365 |
| Molecular Formula | C22H33N5O5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | ethyl 4-[[4-[[2-[(Z)-1-thiophen-2-ylethylideneamino]oxyacetyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2(NC(=O)CO/N=C(/C)c3cccs3)CCNCC2)CC1 |
| InChI | InChI=1S/C22H33N5O5S/c1-3-31-21(30)27-12-6-17(7-13-27)24-20(29)22(8-10-23-11-9-22)25-19(28)15-32-26-16(2)18-5-4-14-33-18/h4-5,14,17,23H,3,6-13,15H2,1-2H3,(H,24,29)(H,25,28)/b26-16- |
| InChIKey | NOLFIIBZKGXZEV-QQXSKIMKSA-N |
| XLogP | 1.46 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|