C23H32N4O4S — CID 74224361
ethyl 4-[[4-[[(E)-3-phenylsulfanylprop-2-enoyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 74224361) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is ethyl 4-[[4-[[(E)-3-phenylsulfanylprop-2-enoyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[[(E)-3-phenylsulfanylprop-2-enoyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 74224361 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | ethyl 4-[[4-[[(E)-3-phenylsulfanylprop-2-enoyl]amino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2(NC(=O)/C=C/Sc3ccccc3)CCNCC2)CC1 |
| InChI | InChI=1S/C23H32N4O4S/c1-2-31-22(30)27-15-8-18(9-16-27)25-21(29)23(11-13-24-14-12-23)26-20(28)10-17-32-19-6-4-3-5-7-19/h3-7,10,17-18,24H,2,8-9,11-16H2,1H3,(H,25,29)(H,26,28)/b17-10+ |
| InChIKey | FXYDKUUKIJCMNV-LICLKQGHSA-N |
| XLogP | 2.27 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|