C21H31N5O7S — CID 25038778
ethyl 4-[[4-[(2-nitrophenyl)methylsulfonylamino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 25038778) has the molecular formula C21H31N5O7S and a molecular weight of 497.57 g/mol. Its IUPAC name is ethyl 4-[[4-[(2-nitrophenyl)methylsulfonylamino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[4-[(2-nitrophenyl)methylsulfonylamino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25038778 |
| Molecular Formula | C21H31N5O7S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | ethyl 4-[[4-[(2-nitrophenyl)methylsulfonylamino]piperidine-4-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2(NS(=O)(=O)Cc3ccccc3[N+](=O)[O-])CCNCC2)CC1 |
| InChI | InChI=1S/C21H31N5O7S/c1-2-33-20(28)25-13-7-17(8-14-25)23-19(27)21(9-11-22-12-10-21)24-34(31,32)15-16-5-3-4-6-18(16)26(29)30/h3-6,17,22,24H,2,7-15H2,1H3,(H,23,27) |
| InChIKey | WVYPHCDTDRVTAC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|