C28H29N3O4 — CID 74228505
(2Z)-2-[(3-nitrophenyl)methylidene]-1-[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decan-2-yl]butan-1-one (PubChem CID 74228505) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is (2Z)-2-[(3-nitrophenyl)methylidene]-1-[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decan-2-yl]butan-1-one.
| Compound Name | (2Z)-2-[(3-nitrophenyl)methylidene]-1-[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decan-2-yl]butan-1-one |
|---|---|
| PubChem CID | 74228505 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2Z)-2-[(3-nitrophenyl)methylidene]-1-[8-(3-phenylprop-2-ynoyl)-2,8-diazaspiro[4.5]decan-2-yl]butan-1-one |
| SMILES | CC/C(=C/c1cccc([N+](=O)[O-])c1)C(=O)N1CCC2(CCN(C(=O)C#Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C28H29N3O4/c1-2-24(19-23-9-6-10-25(20-23)31(34)35)27(33)30-18-15-28(21-30)13-16-29(17-14-28)26(32)12-11-22-7-4-3-5-8-22/h3-10,19-20H,2,13-18,21H2,1H3/b24-19- |
| InChIKey | PGGDQDSERZRQJQ-CLCOLTQESA-N |
| XLogP | 4.28 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|