About N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine
N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine (PubChem CID 74235459) has the molecular formula C18H21ClN2O2
and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine.
Molecular Properties
| Compound Name | N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine |
| PubChem CID | 74235459 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine |
| SMILES | COc1ccc(CN(Cc2ccncc2)C2CC2)c(Cl)c1OC |
| InChI | InChI=1S/C18H21ClN2O2/c1-22-16-6-3-14(17(19)18(16)23-2)12-21(15-4-5-15)11-13-7-9-20-10-8-13/h3,6-10,15H,4-5,11-12H2,1-2H3 |
| InChIKey | RIOQLMKJPGFPRO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine?
The IUPAC name of N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine (CID 74235459) is N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine.
What is the SMILES notation for N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine?
The canonical SMILES for N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine is COc1ccc(CN(Cc2ccncc2)C2CC2)c(Cl)c1OC.
What is the InChIKey of N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine?
The InChIKey is RIOQLMKJPGFPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2O2/c1-22-16-6-3-14(17(19)18(16)23-2)12-21(15-4-5-15)11-13-7-9-20-10-8-13/h3,6-10,15H,4-5,11-12H2,1-2H3.
What are the key properties of N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine?
N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine has a molecular weight of 332.83 g/mol, XLogP of 3.92, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-3,4-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)cyclopropanamine is sourced from PubChem (CID 74235459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).