C16H22Cl2N2O — CID 74239756
2,4-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]phenol (PubChem CID 74239756) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 2,4-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]phenol.
| Compound Name | 2,4-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 74239756 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2,4-dichloro-3-[(3-piperidin-1-ylpyrrolidin-1-yl)methyl]phenol |
| SMILES | Oc1ccc(Cl)c(CN2CCC(N3CCCCC3)C2)c1Cl |
| InChI | InChI=1S/C16H22Cl2N2O/c17-14-4-5-15(21)16(18)13(14)11-19-9-6-12(10-19)20-7-2-1-3-8-20/h4-5,12,21H,1-3,6-11H2 |
| InChIKey | HBPWKQPWRWLLJQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |