C18H18ClN3O2 — CID 74243702
N-[2-(2-chlorophenoxy)ethyl]-3-imidazo[1,2-a]pyridin-2-ylpropanamide (PubChem CID 74243702) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-3-imidazo[1,2-a]pyridin-2-ylpropanamide.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-3-imidazo[1,2-a]pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 74243702 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-3-imidazo[1,2-a]pyridin-2-ylpropanamide |
| SMILES | O=C(CCc1cn2ccccc2n1)NCCOc1ccccc1Cl |
| InChI | InChI=1S/C18H18ClN3O2/c19-15-5-1-2-6-16(15)24-12-10-20-18(23)9-8-14-13-22-11-4-3-7-17(22)21-14/h1-7,11,13H,8-10,12H2,(H,20,23) |
| InChIKey | SOYDQCAVXQLBIJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|