C16H12Cl3N3O2 — CID 8917219
N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 8917219) has the molecular formula C16H12Cl3N3O2 and a molecular weight of 384.65 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 8917219 |
| Molecular Formula | C16H12Cl3N3O2 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NCc1cn2ccccc2n1 |
| InChI | InChI=1S/C16H12Cl3N3O2/c17-11-5-13(19)14(6-12(11)18)24-9-16(23)20-7-10-8-22-4-2-1-3-15(22)21-10/h1-6,8H,7,9H2,(H,20,23) |
| InChIKey | SXGHOYQUUXHVAG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|