C20H24N4O3 — CID 74250727
(3aR,7aS)-N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 74250727) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is (3aR,7aS)-N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | (3aR,7aS)-N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 74250727 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (3aR,7aS)-N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methoxyphenyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | CCc1nnc(-c2ccc(OC)c(NC(=O)N3C[C@H]4CC=CC[C@H]4C3)c2)o1 |
| InChI | InChI=1S/C20H24N4O3/c1-3-18-22-23-19(27-18)13-8-9-17(26-2)16(10-13)21-20(25)24-11-14-6-4-5-7-15(14)12-24/h4-5,8-10,14-15H,3,6-7,11-12H2,1-2H3,(H,21,25)/t14-,15+ |
| InChIKey | GKEYIIVANLUGEO-GASCZTMLSA-N |
| XLogP | 3.74 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|