C22H27N5O — CID 74250997
1-[(1-benzylpiperidin-4-yl)methyl]-3-(3-methylbenzimidazol-5-yl)urea (PubChem CID 74250997) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[(1-benzylpiperidin-4-yl)methyl]-3-(3-methylbenzimidazol-5-yl)urea.
| Compound Name | 1-[(1-benzylpiperidin-4-yl)methyl]-3-(3-methylbenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 74250997 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[(1-benzylpiperidin-4-yl)methyl]-3-(3-methylbenzimidazol-5-yl)urea |
| SMILES | Cn1cnc2ccc(NC(=O)NCC3CCN(Cc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C22H27N5O/c1-26-16-24-20-8-7-19(13-21(20)26)25-22(28)23-14-17-9-11-27(12-10-17)15-18-5-3-2-4-6-18/h2-8,13,16-17H,9-12,14-15H2,1H3,(H2,23,25,28) |
| InChIKey | LYUMRRIMAJWCJA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |