C21H21N3O4 — CID 7431160
5-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-(pyridin-3-ylmethylamino)benzoic acid (PubChem CID 7431160) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-(pyridin-3-ylmethylamino)benzoic acid.
| Compound Name | 5-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-(pyridin-3-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 7431160 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-2-(pyridin-3-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)[C@H]3CCCC[C@@H]3C2=O)ccc1NCc1cccnc1 |
| InChI | InChI=1S/C21H21N3O4/c25-19-15-5-1-2-6-16(15)20(26)24(19)14-7-8-18(17(10-14)21(27)28)23-12-13-4-3-9-22-11-13/h3-4,7-11,15-16,23H,1-2,5-6,12H2,(H,27,28)/t15-,16-/m0/s1 |
| InChIKey | YSVFQQVCMPLENU-HOTGVXAUSA-N |
| XLogP | 3.07 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|