C17H15N3O4 — CID 808781
5-(2,5-dioxopyrrolidin-1-yl)-2-(pyridin-3-ylmethylamino)benzoic acid (PubChem CID 808781) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrolidin-1-yl)-2-(pyridin-3-ylmethylamino)benzoic acid.
| Compound Name | 5-(2,5-dioxopyrrolidin-1-yl)-2-(pyridin-3-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 808781 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-(2,5-dioxopyrrolidin-1-yl)-2-(pyridin-3-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)CCC2=O)ccc1NCc1cccnc1 |
| InChI | InChI=1S/C17H15N3O4/c21-15-5-6-16(22)20(15)12-3-4-14(13(8-12)17(23)24)19-10-11-2-1-7-18-9-11/h1-4,7-9,19H,5-6,10H2,(H,23,24) |
| InChIKey | CKRPULPPPZIMEK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|