C14H12N4O3S — CID 74319536
6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-ethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 74319536) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is 6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-ethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-ethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 74319536 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-ethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCNC(=O)c1cnc2ccc(C=C3SC(=O)NC3=O)cn12 |
| InChI | InChI=1S/C14H12N4O3S/c1-2-15-12(19)9-6-16-11-4-3-8(7-18(9)11)5-10-13(20)17-14(21)22-10/h3-7H,2H2,1H3,(H,15,19)(H,17,20,21) |
| InChIKey | PJQRQFKQNRIHHG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|