C16H10N4NaO2S — CID 87640864
CID 87640864 (PubChem CID 87640864) has the molecular formula C16H10N4NaO2S and a molecular weight of 345.34 g/mol.
| Compound Name | CID 87640864 |
|---|---|
| PubChem CID | 87640864 |
| Molecular Formula | C16H10N4NaO2S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | — |
| SMILES | O=C1NC(=O)/C(=C/c2ccc3ncc(-c4ccncc4)n3c2)S1.[Na] |
| InChI | InChI=1S/C16H10N4O2S.Na/c21-15-13(23-16(22)19-15)7-10-1-2-14-18-8-12(20(14)9-10)11-3-5-17-6-4-11;/h1-9H,(H,19,21,22);/b13-7-; |
| InChIKey | UWIZGOHDTKTJEZ-QCCGTXRUSA-N |
| XLogP | 2.34 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|