C23H22N4O3S — CID 78108342
5-[[3-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]imidazo[1,2-a]pyridin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 78108342) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 5-[[3-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]imidazo[1,2-a]pyridin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]imidazo[1,2-a]pyridin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 78108342 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 5-[[3-[3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]imidazo[1,2-a]pyridin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc3ncc(-c4cccc(CN5CCC(O)CC5)c4)n3c2)S1 |
| InChI | InChI=1S/C23H22N4O3S/c28-18-6-8-26(9-7-18)13-15-2-1-3-17(10-15)19-12-24-21-5-4-16(14-27(19)21)11-20-22(29)25-23(30)31-20/h1-5,10-12,14,18,28H,6-9,13H2,(H,25,29,30) |
| InChIKey | DKNHJAYRGKMWOB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|