C17H14N2O4S — CID 58423183
(5Z)-5-[(4,5-dimethoxy-2-pyridin-4-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58423183) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is (5Z)-5-[(4,5-dimethoxy-2-pyridin-4-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4,5-dimethoxy-2-pyridin-4-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58423183 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (5Z)-5-[(4,5-dimethoxy-2-pyridin-4-ylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)NC2=O)c(-c2ccncc2)cc1OC |
| InChI | InChI=1S/C17H14N2O4S/c1-22-13-7-11(8-15-16(20)19-17(21)24-15)12(9-14(13)23-2)10-3-5-18-6-4-10/h3-9H,1-2H3,(H,19,20,21)/b15-8- |
| InChIKey | YSXGBIUDHZBYIG-NVNXTCNLSA-N |
| XLogP | 3.09 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|