C25H26FN5O2S — CID 74324563
N-[1-[1-(6-fluoro-3-pyridinyl)indazol-4-yl]pyrrolidin-3-yl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 74324563) has the molecular formula C25H26FN5O2S and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[1-[1-(6-fluoro-3-pyridinyl)indazol-4-yl]pyrrolidin-3-yl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[1-[1-(6-fluoro-3-pyridinyl)indazol-4-yl]pyrrolidin-3-yl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 74324563 |
| Molecular Formula | C25H26FN5O2S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[1-[1-(6-fluoro-3-pyridinyl)indazol-4-yl]pyrrolidin-3-yl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC2CCN(c3cccc4c3cnn4-c3ccc(F)nc3)C2)c(C)c1 |
| InChI | InChI=1S/C25H26FN5O2S/c1-16-11-17(2)25(18(3)12-16)34(32,33)29-19-9-10-30(15-19)22-5-4-6-23-21(22)14-28-31(23)20-7-8-24(26)27-13-20/h4-8,11-14,19,29H,9-10,15H2,1-3H3 |
| InChIKey | RGFNWVUMSILGAH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|