C22H26O16S — CID 74342620
[3,5-dihydroxy-2-(sulfooxymethyl)-6-(3,4,5-trimethoxyphenoxy)oxan-4-yl] 3,4,5-trihydroxybenzoate (PubChem CID 74342620) has the molecular formula C22H26O16S and a molecular weight of 578.50 g/mol. Its IUPAC name is [3,5-dihydroxy-2-(sulfooxymethyl)-6-(3,4,5-trimethoxyphenoxy)oxan-4-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [3,5-dihydroxy-2-(sulfooxymethyl)-6-(3,4,5-trimethoxyphenoxy)oxan-4-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 74342620 |
| Molecular Formula | C22H26O16S |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | [3,5-dihydroxy-2-(sulfooxymethyl)-6-(3,4,5-trimethoxyphenoxy)oxan-4-yl] 3,4,5-trihydroxybenzoate |
| SMILES | COc1cc(OC2OC(COS(=O)(=O)O)C(O)C(OC(=O)c3cc(O)c(O)c(O)c3)C2O)cc(OC)c1OC |
| InChI | InChI=1S/C22H26O16S/c1-32-13-6-10(7-14(33-2)19(13)34-3)36-22-18(27)20(17(26)15(37-22)8-35-39(29,30)31)38-21(28)9-4-11(23)16(25)12(24)5-9/h4-7,15,17-18,20,22-27H,8H2,1-3H3,(H,29,30,31) |
| InChIKey | KNLSZQQVYGVAPL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 237.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|