C16H15N3O4 — CID 743877
benzotriazol-1-yl-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 743877) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is benzotriazol-1-yl-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | benzotriazol-1-yl-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 743877 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | benzotriazol-1-yl-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)n2nnc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C16H15N3O4/c1-21-13-8-10(9-14(22-2)15(13)23-3)16(20)19-12-7-5-4-6-11(12)17-18-19/h4-9H,1-3H3 |
| InChIKey | NEKHFHOJHQTZQN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |