C8H15NO5 — CID 74394391
5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3,6,7-triol (PubChem CID 74394391) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3,6,7-triol.
| Compound Name | 5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3,6,7-triol |
|---|---|
| PubChem CID | 74394391 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3,6,7-triol |
| SMILES | OCC1OC2C(O)CNC2C(O)C1O |
| InChI | InChI=1S/C8H15NO5/c10-2-4-6(12)7(13)5-8(14-4)3(11)1-9-5/h3-13H,1-2H2 |
| InChIKey | MOHKQMHTZUOTRI-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |