C8H15NO4 — CID 166975574
(3aS,7aS)-5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-6,7-diol (PubChem CID 166975574) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (3aS,7aS)-5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-6,7-diol.
| Compound Name | (3aS,7aS)-5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-6,7-diol |
|---|---|
| PubChem CID | 166975574 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (3aS,7aS)-5-(hydroxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-6,7-diol |
| SMILES | OCC1O[C@H]2CCN[C@H]2C(O)C1O |
| InChI | InChI=1S/C8H15NO4/c10-3-5-7(11)8(12)6-4(13-5)1-2-9-6/h4-12H,1-3H2/t4-,5?,6+,7?,8?/m0/s1 |
| InChIKey | AYEWYLDBUCBUGN-GRONODGRSA-N |
| XLogP | -2.17 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |