C8H9ClN4O2 — CID 74401488
2-chloro-N-[5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]acetamide (PubChem CID 74401488) has the molecular formula C8H9ClN4O2 and a molecular weight of 228.64 g/mol. Its IUPAC name is 2-chloro-N-[5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]acetamide.
| Compound Name | 2-chloro-N-[5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 74401488 |
| Molecular Formula | C8H9ClN4O2 |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-chloro-N-[5-(N'-hydroxycarbamimidoyl)-2-pyridinyl]acetamide |
| SMILES | NC(=NO)c1ccc(NC(=O)CCl)nc1 |
| InChI | InChI=1S/C8H9ClN4O2/c9-3-7(14)12-6-2-1-5(4-11-6)8(10)13-15/h1-2,4,15H,3H2,(H2,10,13)(H,11,12,14) |
| InChIKey | HLXMZXGVMXLJPN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|