C22H32N5O+ — CID 7440560
diethyl-[3-[[2-(4-methoxyphenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]azanium (PubChem CID 7440560) has the molecular formula C22H32N5O+ and a molecular weight of 382.53 g/mol. Its IUPAC name is diethyl-[3-[[2-(4-methoxyphenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]azanium.
| Compound Name | diethyl-[3-[[2-(4-methoxyphenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]azanium |
|---|---|
| PubChem CID | 7440560 |
| Molecular Formula | C22H32N5O+ |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | diethyl-[3-[[2-(4-methoxyphenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl]azanium |
| SMILES | CC[NH+](CC)CCCNc1c(C)c(C)nc2cc(-c3ccc(OC)cc3)nn12 |
| InChI | InChI=1S/C22H31N5O/c1-6-26(7-2)14-8-13-23-22-16(3)17(4)24-21-15-20(25-27(21)22)18-9-11-19(28-5)12-10-18/h9-12,15,23H,6-8,13-14H2,1-5H3/p+1 |
| InChIKey | QLLOEAFUYKIPIQ-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|