C21H29ClN5+ — CID 7440565
3-[[2-(3-chlorophenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-diethylazanium (PubChem CID 7440565) has the molecular formula C21H29ClN5+ and a molecular weight of 386.95 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-diethylazanium.
| Compound Name | 3-[[2-(3-chlorophenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 7440565 |
| Molecular Formula | C21H29ClN5+ |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)-5,6-dimethylpyrazolo[1,5-a]pyrimidin-7-yl]amino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCNc1c(C)c(C)nc2cc(-c3cccc(Cl)c3)nn12 |
| InChI | InChI=1S/C21H28ClN5/c1-5-26(6-2)12-8-11-23-21-15(3)16(4)24-20-14-19(25-27(20)21)17-9-7-10-18(22)13-17/h7,9-10,13-14,23H,5-6,8,11-12H2,1-4H3/p+1 |
| InChIKey | XDIPMAYVGYSDBC-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 46.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|