C23H32FN2O+ — CID 7441107
1-(2-fluorophenyl)-4-[(4-hexoxyphenyl)methyl]piperazin-4-ium (PubChem CID 7441107) has the molecular formula C23H32FN2O+ and a molecular weight of 371.52 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(4-hexoxyphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2-fluorophenyl)-4-[(4-hexoxyphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7441107 |
| Molecular Formula | C23H32FN2O+ |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(4-hexoxyphenyl)methyl]piperazin-4-ium |
| SMILES | CCCCCCOc1ccc(C[NH+]2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C23H31FN2O/c1-2-3-4-7-18-27-21-12-10-20(11-13-21)19-25-14-16-26(17-15-25)23-9-6-5-8-22(23)24/h5-6,8-13H,2-4,7,14-19H2,1H3/p+1 |
| InChIKey | AQHYVEYJYJTNEZ-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|