C17H12N5O4S- — CID 7441863
3-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-nitrophenolate (PubChem CID 7441863) has the molecular formula C17H12N5O4S- and a molecular weight of 382.38 g/mol. Its IUPAC name is 3-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-nitrophenolate.
| Compound Name | 3-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7441863 |
| Molecular Formula | C17H12N5O4S- |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3-[(6R)-3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-4-nitrophenolate |
| SMILES | CSc1nnc2c(n1)O[C@H](c1cc([O-])ccc1[N+](=O)[O-])Nc1ccccc1-2 |
| InChI | InChI=1S/C17H13N5O4S/c1-27-17-19-16-14(20-21-17)10-4-2-3-5-12(10)18-15(26-16)11-8-9(23)6-7-13(11)22(24)25/h2-8,15,18,23H,1H3/p-1/t15-/m1/s1 |
| InChIKey | FSQWMFRSGFTAMY-OAHLLOKOSA-M |
| XLogP | 2.75 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|