C16H27NO7 — CID 74421600
tert-butyl 4-(acetyloxymethyl)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 74421600) has the molecular formula C16H27NO7 and a molecular weight of 345.39 g/mol. Its IUPAC name is tert-butyl 4-(acetyloxymethyl)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 4-(acetyloxymethyl)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 74421600 |
| Molecular Formula | C16H27NO7 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | tert-butyl 4-(acetyloxymethyl)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(=O)OCC1C2OC(C)(C)OC2C(CO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO7/c1-9(19)21-8-11-13-12(22-16(5,6)23-13)10(7-18)17(11)14(20)24-15(2,3)4/h10-13,18H,7-8H2,1-6H3 |
| InChIKey | SWROQBITYTVDDJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |