C14H23NO — CID 74432948
1-(propan-2-ylamino)undeca-3,7,9-trien-2-one (PubChem CID 74432948) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(propan-2-ylamino)undeca-3,7,9-trien-2-one.
| Compound Name | 1-(propan-2-ylamino)undeca-3,7,9-trien-2-one |
|---|---|
| PubChem CID | 74432948 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(propan-2-ylamino)undeca-3,7,9-trien-2-one |
| SMILES | CC=CC=CCCC=CC(=O)CNC(C)C |
| InChI | InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-11-14(16)12-15-13(2)3/h4-7,10-11,13,15H,8-9,12H2,1-3H3 |
| InChIKey | FCCSGQYKVFJWEH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|