C29H28N2O4 — CID 74440151
2-(3-cyclopentyloxyphenyl)-3-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-phenylprop-2-enamide (PubChem CID 74440151) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is 2-(3-cyclopentyloxyphenyl)-3-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-phenylprop-2-enamide.
| Compound Name | 2-(3-cyclopentyloxyphenyl)-3-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 74440151 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 2-(3-cyclopentyloxyphenyl)-3-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(C=C(C(=O)Nc2ccccc2)c2cccc(OC3CCCC3)c2)cc1)NO |
| InChI | InChI=1S/C29H28N2O4/c32-28(31-34)18-17-21-13-15-22(16-14-21)19-27(29(33)30-24-8-2-1-3-9-24)23-7-6-12-26(20-23)35-25-10-4-5-11-25/h1-3,6-9,12-20,25,34H,4-5,10-11H2,(H,30,33)(H,31,32) |
| InChIKey | VNGXPHUVRBXQTP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|