C24H34N4O4 — CID 74440930
N-[1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide (PubChem CID 74440930) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 74440930 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-[1-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-2,5-dioxopyrrolidin-3-yl]cyclohexanecarboxamide |
| SMILES | COc1ccccc1N1CCN(CCN2C(=O)CC(NC(=O)C3CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C24H34N4O4/c1-32-21-10-6-5-9-20(21)27-14-11-26(12-15-27)13-16-28-22(29)17-19(24(28)31)25-23(30)18-7-3-2-4-8-18/h5-6,9-10,18-19H,2-4,7-8,11-17H2,1H3,(H,25,30) |
| InChIKey | FLGMVEBUAIPRHI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|