C19H19N2O6- — CID 7446689
2-[(2,6-dimethylphenyl)-[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-4-nitrophenolate (PubChem CID 7446689) has the molecular formula C19H19N2O6- and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)-[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-4-nitrophenolate.
| Compound Name | 2-[(2,6-dimethylphenyl)-[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7446689 |
| Molecular Formula | C19H19N2O6- |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)-[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-4-nitrophenolate |
| SMILES | COC(=O)[C@H](C)N(C(=O)c1cc([N+](=O)[O-])ccc1[O-])c1c(C)cccc1C |
| InChI | InChI=1S/C19H20N2O6/c1-11-6-5-7-12(2)17(11)20(13(3)19(24)27-4)18(23)15-10-14(21(25)26)8-9-16(15)22/h5-10,13,22H,1-4H3/p-1/t13-/m0/s1 |
| InChIKey | WLZWMHIKUITGTA-ZDUSSCGKSA-M |
| XLogP | 2.49 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|