C15H20O4 — CID 74493494
2,6-dihydroxy-2-(2-hydroxy-4-methylphenyl)-6-methylhept-4-en-3-one (PubChem CID 74493494) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2,6-dihydroxy-2-(2-hydroxy-4-methylphenyl)-6-methylhept-4-en-3-one.
| Compound Name | 2,6-dihydroxy-2-(2-hydroxy-4-methylphenyl)-6-methylhept-4-en-3-one |
|---|---|
| PubChem CID | 74493494 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2,6-dihydroxy-2-(2-hydroxy-4-methylphenyl)-6-methylhept-4-en-3-one |
| SMILES | Cc1ccc(C(C)(O)C(=O)C=CC(C)(C)O)c(O)c1 |
| InChI | InChI=1S/C15H20O4/c1-10-5-6-11(12(16)9-10)15(4,19)13(17)7-8-14(2,3)18/h5-9,16,18-19H,1-4H3 |
| InChIKey | QXFMVTGSYGOMCS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|