C19H22O — CID 54425254
2-[2-(3,5-dimethylphenyl)but-3-en-2-yl]-5-methylphenol (PubChem CID 54425254) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenyl)but-3-en-2-yl]-5-methylphenol.
| Compound Name | 2-[2-(3,5-dimethylphenyl)but-3-en-2-yl]-5-methylphenol |
|---|---|
| PubChem CID | 54425254 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[2-(3,5-dimethylphenyl)but-3-en-2-yl]-5-methylphenol |
| SMILES | C=CC(C)(c1cc(C)cc(C)c1)c1ccc(C)cc1O |
| InChI | InChI=1S/C19H22O/c1-6-19(5,16-10-14(3)9-15(4)11-16)17-8-7-13(2)12-18(17)20/h6-12,20H,1H2,2-5H3 |
| InChIKey | MMRUVOCHICDIDF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|