C24H18ClFN4 — CID 7451972
4-(4-chlorophenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine (PubChem CID 7451972) has the molecular formula C24H18ClFN4 and a molecular weight of 416.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 7451972 |
| Molecular Formula | C24H18ClFN4 |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(E)-1-(4-fluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine |
| SMILES | C/C(=N\Nc1nc(-c2ccccc2)cc(-c2ccc(Cl)cc2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H18ClFN4/c1-16(17-9-13-21(26)14-10-17)29-30-24-27-22(18-5-3-2-4-6-18)15-23(28-24)19-7-11-20(25)12-8-19/h2-15H,1H3,(H,27,28,30)/b29-16+ |
| InChIKey | DMVDDXFIFIBCFN-MUFRIFMGSA-N |
| XLogP | 6.44 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|