C24H14BrF5N4 — CID 5339080
4-(4-bromophenyl)-N-[(Z)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine (PubChem CID 5339080) has the molecular formula C24H14BrF5N4 and a molecular weight of 533.30 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[(Z)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine.
| Compound Name | 4-(4-bromophenyl)-N-[(Z)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 5339080 |
| Molecular Formula | C24H14BrF5N4 |
| Molecular Weight | 533.30 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 4-(4-bromophenyl)-N-[(Z)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]-6-phenylpyrimidin-2-amine |
| SMILES | C/C(=N/Nc1nc(-c2ccccc2)cc(-c2ccc(Br)cc2)n1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H14BrF5N4/c1-12(18-19(26)21(28)23(30)22(29)20(18)27)33-34-24-31-16(13-5-3-2-4-6-13)11-17(32-24)14-7-9-15(25)10-8-14/h2-11H,1H3,(H,31,32,34)/b33-12- |
| InChIKey | WYYXOTKUPHTKFV-OHSLDDHESA-N |
| XLogP | 7.10 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.30 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|