C24H15BrClF3N4O6 — CID 74538862
1-[5-(4-bromophenyl)-3-[3-chloro-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 74538862) has the molecular formula C24H15BrClF3N4O6 and a molecular weight of 627.76 g/mol. Its IUPAC name is 1-[5-(4-bromophenyl)-3-[3-chloro-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[5-(4-bromophenyl)-3-[3-chloro-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 74538862 |
| Molecular Formula | C24H15BrClF3N4O6 |
| Molecular Weight | 627.76 g/mol |
| Exact Mass | 625.98 |
| IUPAC Name | 1-[5-(4-bromophenyl)-3-[3-chloro-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2ccc(Br)cc2)CC1c1cccc(Cl)c1Oc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H15BrClF3N4O6/c1-12(34)31-19(11-18(30-31)13-5-7-15(25)8-6-13)16-3-2-4-17(26)22(16)39-23-20(32(35)36)9-14(24(27,28)29)10-21(23)33(37)38/h2-10,19H,11H2,1H3 |
| InChIKey | OYKHPEMSYQGMQO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.76 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|