C21H27ClO4 — CID 7457630
[2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 7457630) has the molecular formula C21H27ClO4 and a molecular weight of 378.90 g/mol. Its IUPAC name is [2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7457630 |
| Molecular Formula | C21H27ClO4 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OC(=O)COC(=O)/C=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H27ClO4/c1-14(2)18-9-7-15(3)11-19(18)26-21(24)13-25-20(23)10-8-16-5-4-6-17(22)12-16/h4-6,8,10,12,14-15,18-19H,7,9,11,13H2,1-3H3/b10-8+/t15-,18-,19-/m1/s1 |
| InChIKey | PNSAFPSIAFPWSP-SRXLTFOMSA-N |
| XLogP | 4.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|