C16H22Cl2N3O2+ — CID 7458620
2-(2,4-dichlorophenoxy)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide (PubChem CID 7458620) has the molecular formula C16H22Cl2N3O2+ and a molecular weight of 359.28 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 7458620 |
| Molecular Formula | C16H22Cl2N3O2+ |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(1-propan-2-ylpiperidin-1-ium-4-ylidene)amino]acetamide |
| SMILES | CC(C)[NH+]1CCC(=NNC(=O)COc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-11(2)21-7-5-13(6-8-21)19-20-16(22)10-23-15-4-3-12(17)9-14(15)18/h3-4,9,11H,5-8,10H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | XEXYQPYPYVDJPB-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|