C11H5Cl2NO5 — CID 745871
5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid (PubChem CID 745871) has the molecular formula C11H5Cl2NO5 and a molecular weight of 302.07 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid.
| Compound Name | 5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 745871 |
| Molecular Formula | C11H5Cl2NO5 |
| Molecular Weight | 302.07 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C11H5Cl2NO5/c12-6-3-5(14(17)18)4-7(13)10(6)8-1-2-9(19-8)11(15)16/h1-4H,(H,15,16) |
| InChIKey | BFXJURJPVKFDPR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.07 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|